1,4-Benzenediamine,N1,N4-bis(4-methoxyphenyl)- structure
|
Common Name | 1,4-Benzenediamine,N1,N4-bis(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 24413-67-0 | Molecular Weight | 320.38500 | |
| Density | 1.188g/cm3 | Boiling Point | 514.7ºC at 760mmHg | |
| Molecular Formula | C20H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.9ºC | |
| Name | 1-N,4-N-bis(4-methoxyphenyl)benzene-1,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 514.7ºC at 760mmHg |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.38500 |
| Flash Point | 211.9ºC |
| Exact Mass | 320.15200 |
| PSA | 42.52000 |
| LogP | 5.33700 |
| Vapour Pressure | 1.06E-10mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | YKKLKYWMPFWRDG-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccc(Nc3ccc(OC)cc3)cc2)cc1 |
|
~91%
1,4-Benzenediam... CAS#:24413-67-0 |
| Literature: Ito, Akihiro; Yokoyama, Yuichiro; Aihara, Ryosuke; Fukui, Koji; Eguchi, Shoko; Shizu, Katsuyuki; Sato, Tohru; Tanaka, Kazuyoshi Angewandte Chemie - International Edition, 2010 , vol. 49, # 44 p. 8205 - 8208 |
|
~%
1,4-Benzenediam... CAS#:24413-67-0 |
| Literature: Buu-Hoi Journal of the Chemical Society, 1952 , p. 4346,4348,4349 |
|
~13%
1,4-Benzenediam... CAS#:24413-67-0 |
| Literature: Yudina, Larisa N.; Bergman, Jan Tetrahedron, 2003 , vol. 59, # 8 p. 1265 - 1275 |
| N,N'-di(4-anisyl)-1,4-benzenediamine |
| N,N'-bis(4-methoxyphenyl)-1,4-phenylenediamine |
| N,N'-Bis-(4-methoxy-phenyl)-p-phenylendiamin |
| N,N'-bis-(4-methoxy-phenyl)-p-phenylenediamine |
| N,N'-bis(4-methoxyphenyl)-1,4-benzenediamine |
| bis(p-methoxyphenyl)-p-phenylenediamine |
| n,n'-bis(4-methoxyphenyl)benzene-1,4-diamine |