7-[2-(diethylamino)ethoxy]-4-methylchromen-2-one structure
|
Common Name | 7-[2-(diethylamino)ethoxy]-4-methylchromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 24416-77-1 | Molecular Weight | 275.34300 | |
| Density | 1.106g/cm3 | Boiling Point | 419.5ºC at 760mmHg | |
| Molecular Formula | C16H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5ºC | |
| Name | 7-[2-(diethylamino)ethoxy]-4-methylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 419.5ºC at 760mmHg |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.34300 |
| Flash Point | 207.5ºC |
| Exact Mass | 275.15200 |
| PSA | 42.68000 |
| LogP | 2.82200 |
| Vapour Pressure | 3.03E-07mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | AXFDKDUQMWOLKG-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOc1ccc2c(C)cc(=O)oc2c1 |
|
~57%
7-[2-(diethylam... CAS#:24416-77-1 |
| Literature: Trykowska Konc, Joanna; Hejchman, Elzbieta; Kruszewska, Hanna; Wolska, Irena; Maciejewska, Dorota European Journal of Medicinal Chemistry, 2011 , vol. 46, # 6 p. 2252 - 2263 |
|
~%
7-[2-(diethylam... CAS#:24416-77-1 |
| Literature: Massarani Farmaco, Edizione Scientifica, 1957 , vol. 12, p. 691,693 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7-[2-(N,N-diethylamino)ethoxy]-4-methylchromen-2-one |
| 2H-1-Benzopyran-2-one,7-(2-(diethylamino)ethoxy)-4-methyl |
| 7-(2-diethylamino-ethoxy)-4-methyl-coumarin |
| 7-(2-(Diethylamino)ethoxy)-4-methyl-2H-1-benzopyran-2-one |
| 7-(2-Diaethylamino-aethoxy)-4-methyl-cumarin |
| 7-[2-(diethylamino)ethoxy]-4-methyl-2h-chromen-2-one |