Hydrazinecarboxylicacid, 2,2-bis(3-chloro-2-buten-1-yl)-, ethyl ester structure
|
Common Name | Hydrazinecarboxylicacid, 2,2-bis(3-chloro-2-buten-1-yl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 24423-60-7 | Molecular Weight | 281.17900 | |
| Density | 1.175g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H18Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[bis(3-chlorobut-2-enyl)amino]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.175g/cm3 |
|---|---|
| Molecular Formula | C11H18Cl2N2O2 |
| Molecular Weight | 281.17900 |
| Exact Mass | 280.07500 |
| PSA | 41.57000 |
| LogP | 3.62560 |
| Index of Refraction | 1.51 |
| InChIKey | VOBVNJBBCQSCRJ-NXZHAISVSA-N |
| SMILES | CCOC(=O)NN(CC=C(C)Cl)CC=C(C)Cl |
|
~%
Hydrazinecarbox... CAS#:24423-60-7 |
| Literature: Smith,W.T.; Chen,W.-Y. Journal of Medicinal Chemistry, 1969 , vol. 12, p. 727 - 728 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ethyl 2,2-bis(2-chloroprop-2-en-1-yl)hydrazinecarboxylate |
| Aethyl-3,3-bis-(3-chlor-2-butenyl)-carbazat |
| Aethyl-3,3-bis-<2-chlor-allyl>carbazat |