4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine
Modify Date: 2026-08-17 17:57:38
4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine structure
|
Common Name | 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 2443871-81-4 | Molecular Weight | 268.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClFN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10ClFN2O2 |
|---|---|
| Molecular Weight | 268.67 |
| InChIKey | AAZTYPDJSCRTKM-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2ncnc(Cl)c2F)c1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2443871-81-4? |
| A: Chinese name of 2443871-81-4 is 2443871-81-4. |
| Q: What is the InChIKey of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine? |
| A: InChIKey of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine is AAZTYPDJSCRTKM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine? |
| A: Molecular formula of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine is C12H10ClFN2O2. |
| Q: What is the English name of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine? |
| A: The English name of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine is 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine. |
| Q: What is the SMILES notation of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine? |
| A: SMILES notation of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine is COc1cccc(-c2ncnc(Cl)c2F)c1OC. |
| Q: What is the molecular weight of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine? |
| A: Molecular weight of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine is 268.67. |
| Q: What is the CAS number of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine? |
| A: CAS number of 4-Chloro-6-(2,3-dimethoxyphenyl)-5-fluoropyrimidine is 2443871-81-4. |