disodium 4,4'-isopropylidenediphenolate structure
|
Common Name | disodium 4,4'-isopropylidenediphenolate | ||
|---|---|---|---|---|
| CAS Number | 2444-90-8 | Molecular Weight | 272.25000 | |
| Density | 1.143g/cm3 | Boiling Point | 400.8ºC at 760mmHg | |
| Molecular Formula | C15H14Na2O2 | Melting Point | 150-155ºC (solidification range) | |
| MSDS | N/A | Flash Point | 192.4ºC | |
| Name | disodium,4-[2-(4-oxidophenyl)propan-2-yl]phenolate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 400.8ºC at 760mmHg |
| Melting Point | 150-155ºC (solidification range) |
| Molecular Formula | C15H14Na2O2 |
| Molecular Weight | 272.25000 |
| Flash Point | 192.4ºC |
| Exact Mass | 272.07900 |
| PSA | 46.12000 |
| LogP | 4.30010 |
| Vapour Pressure | 5.34E-07mmHg at 25°C |
| InChIKey | WGMBWDBRVAKMOO-UHFFFAOYSA-L |
| SMILES | CC(C)(c1ccc([O-])cc1)c1ccc([O-])cc1.[Na+].[Na+] |
|
~95%
disodium 4,4'-i... CAS#:2444-90-8 |
| Literature: CHANGCHUN INSTITUTE OF APPLIED CHEMISTRY Patent: US2005/272957 A1, 2005 ; Location in patent: Page/Page column 4 ; |
| 2,2-bis-(4-hydroxyphenyl)propane disodium salt |
| disodium salt of 2,2-bis(4-hydroxyphenyl)propane |
| Phenol,4,4'-(1-methylethylidene)bis-,disodium salt |
| disodium salt of 2,2-bis(p-hydroxyphenyl)propane |
| 4,4'-Isopropylidinebisphenol,disodium salt |
| 4,4'-(1-Methylethylidene)bisphenol disodium salt |
| disodium salt of bisphenol A |
| BISPHENOL A DISODIUM SALT |
| EINECS 219-488-3 |
| bisphenol A sodium salt |
| Diphenylolpropane disodium salt |
| Phenol,4,4'-isopropylidenedi-,disodium salt |
| Disodium 4,4'-isopropylidenediphenolate |