4,5-DIHYDRO-2H-BENZO[G]INDAZOLE structure
|
Common Name | 4,5-DIHYDRO-2H-BENZO[G]INDAZOLE | ||
|---|---|---|---|---|
| CAS Number | 24445-06-5 | Molecular Weight | 170.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-dihydro-1H-benzo[g]indazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10N2 |
|---|---|
| Molecular Weight | 170.21000 |
| Exact Mass | 170.08400 |
| PSA | 28.68000 |
| LogP | 2.17530 |
| InChIKey | IJZPDJZOELSEKV-UHFFFAOYSA-N |
| SMILES | c1ccc2c(c1)CCc1cn[nH]c1-2 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: Compound was tested for inhibition of the rat passive cutaneous anaphylaxis (PCA) 1 h...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL784347
|
|
Name: Compound was tested for inhibition of the rat passive cutaneous anaphylaxis (PCA) 3h ...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL784348
|
| 4,5-dihydro-1(2)H-benzo[g]indazole |
| 4,5-Dihydro-1(2)H-benz[g]indazol |