4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol
Modify Date: 2025-11-07 05:59:54
![4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol Structure](https://www.chemsrc.com/extcaspic/278/2444575-52-2.png)
4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol structure
|
Common Name | 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol | ||
|---|---|---|---|---|
| CAS Number | 2444575-52-2 | Molecular Weight | 238.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18N2O3 |
|---|---|
| Molecular Weight | 238.28 |
| InChIKey | GDVQFMGTVGGBOG-UHFFFAOYSA-N |
| SMILES | COc1ccc(NCC2(O)CCOCC2)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol? |
| A: The English name of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol is 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol. |
| Q: What is the molecular weight of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol? |
| A: Molecular weight of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol is 238.28. |
| Q: What is the Chinese name of 2444575-52-2? |
| A: Chinese name of 2444575-52-2 is 2444575-52-2. |
| Q: What is the SMILES notation of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol? |
| A: SMILES notation of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol is COc1ccc(NCC2(O)CCOCC2)cn1. |
| Q: What is the molecular formula of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol? |
| A: Molecular formula of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol is C12H18N2O3. |
| Q: What is the CAS number of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol? |
| A: CAS number of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol is 2444575-52-2. |
| Q: What is the InChIKey of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol? |
| A: InChIKey of 4-{[(6-Methoxypyridin-3-yl)amino]methyl}oxan-4-ol is GDVQFMGTVGGBOG-UHFFFAOYSA-N. |