Carboxy pyridostatin trifluoroacetate salt
Modify Date: 2025-10-26 18:10:40
Carboxy pyridostatin trifluoroacetate salt structure
|
Common Name | Carboxy pyridostatin trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 2444713-88-4 | Molecular Weight | 820.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H35F3N10O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Carboxy pyridostatin trifluoroacetate saltCarboxy pyridostatin trifluoroacetate salt has the peculiarity to exhibit high molecular specificity for RNA over DNA G4s. |
| Name | Carboxy pyridostatin trifluoroacetate salt |
|---|
| Description | Carboxy pyridostatin trifluoroacetate salt has the peculiarity to exhibit high molecular specificity for RNA over DNA G4s. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C37H35F3N10O9 |
|---|---|
| Molecular Weight | 820.73 |
| InChIKey | WTHDBHUUPVHFQX-UHFFFAOYSA-N |
| SMILES | NCCOc1cc(NC(=O)c2cc(OCc3cn(CCC(=O)O)nn3)cc(C(=O)Nc3cc(OCCN)c4ccccc4n3)n2)nc2ccccc12.O=C(O)C(F)(F)F |