1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine
Modify Date: 2026-09-28 11:12:09
![1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine Structure](https://www.chemsrc.com/extcaspic/319/2445708-29-0.png)
1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine structure
|
Common Name | 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 2445708-29-0 | Molecular Weight | 292.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14BrN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14BrN3 |
|---|---|
| Molecular Weight | 292.17 |
| InChIKey | MEHSTQRRSGRTFH-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccccc2Br)nc(CN)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine? |
| A: CAS number of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine is 2445708-29-0. |
| Q: What is the SMILES notation of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine? |
| A: SMILES notation of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine is Cc1nc(-c2ccccc2Br)nc(CN)c1C. |
| Q: What is the Chinese name of 2445708-29-0? |
| A: Chinese name of 2445708-29-0 is 2445708-29-0. |
| Q: What is the molecular formula of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine? |
| A: Molecular formula of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine is C13H14BrN3. |
| Q: What is the molecular weight of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine? |
| A: Molecular weight of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine is 292.17. |
| Q: What is the InChIKey of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine? |
| A: InChIKey of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine is MEHSTQRRSGRTFH-UHFFFAOYSA-N. |
| Q: What is the English name of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine? |
| A: The English name of 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine is 1-[2-(2-Bromophenyl)-5,6-dimethylpyrimidin-4-yl]methanamine. |