N-(2-methyl-2-nitropropyl)-4-nitrosoaniline structure
|
Common Name | N-(2-methyl-2-nitropropyl)-4-nitrosoaniline | ||
|---|---|---|---|---|
| CAS Number | 24458-48-8 | Molecular Weight | 223.22900 | |
| Density | 1.23g/cm3 | Boiling Point | 399.7ºC at 760 mmHg | |
| Molecular Formula | C10H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.5ºC | |
| Name | N-(2-methyl-2-nitropropyl)-4-nitrosoaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 399.7ºC at 760 mmHg |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.22900 |
| Flash Point | 195.5ºC |
| Exact Mass | 223.09600 |
| PSA | 87.28000 |
| LogP | 3.14790 |
| Vapour Pressure | 1.34E-06mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | HGAHFVOTRBLLFI-UHFFFAOYSA-N |
| SMILES | CC(C)(CNc1ccc(N=O)cc1)[N+](=O)[O-] |
| HS Code | 2921430090 |
|---|
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 246-267-9 |
| N-(2-Methyl-2-nitropropyl)-p-nitrosobenzenamine |
| Aniline,N-(2-methyl-2-nitropropyl)-p-nitroso |
| Nitrol (promoter) |
| N-(2-Methyl-2-nitropropyl)-p-nitrosoaniline |
| N-(p-Nitrosoanilinomethyl)-2-nitropropane |
| N-(2-Methyl-2-nitropropyl)-p-nitrosoanilin |
| N-(2-Methyl-2-nitropropyl)-4-nitrosobenzamine |