9-Hydroxystearic acid methyl ester structure
|
Common Name | 9-Hydroxystearic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 2447-53-2 | Molecular Weight | 314.50300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H38O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 9-hydroxyoctadecanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H38O3 |
|---|---|
| Molecular Weight | 314.50300 |
| Exact Mass | 314.28200 |
| PSA | 46.53000 |
| LogP | 5.39170 |
| InChIKey | QDFNTRIETZJNIC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(O)CCCCCCCC(=O)OC |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 9-hydroxyoctadecanoic acid methyl ester |
| 9-hydroxystearic acid methyl ester |
| (+-)-9-Hydroxy-octadecansaeure-methylester |
| Methyl 9-hydroxystearate |
| 8-Hydroxy-heptadecan-carbonsaeure-(1)-methylester |
| Octadecanoic acid,9-hydroxy-,methyl ester |