2-[(4-Methylphenyl)thio]-4,6-bis(trichloromethyl)-1,3,5-triazine structure
|
Common Name | 2-[(4-Methylphenyl)thio]-4,6-bis(trichloromethyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 24478-01-1 | Molecular Weight | 437.98700 | |
| Density | 1.68g/cm3 | Boiling Point | 484ºC at 760 mmHg | |
| Molecular Formula | C12H7Cl6N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.5ºC | |
| Name | 2-(4-methylphenyl)sulfanyl-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 484ºC at 760 mmHg |
| Molecular Formula | C12H7Cl6N3S |
| Molecular Weight | 437.98700 |
| Flash Point | 246.5ºC |
| Exact Mass | 434.84900 |
| PSA | 63.97000 |
| LogP | 5.98460 |
| Vapour Pressure | 4.69E-09mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | HCXWWANCOSDRNI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Sc2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,3,5-Triazine,2-[(4-methylphenyl)thio]-4,6-bis(trichloromethyl) |
| 2-p-tolylsulfanyl-4,6-bis-trichloromethyl-[1,3,5]triazine |
| 2-[(4-methylphenyl)sulfanyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
| s-Triazine,2-(p-tolylthio)-4,6-bis(trichloromethyl) |