Benzamide,3,4-dichloro-N-(4-chlorophenyl)- structure
|
Common Name | Benzamide,3,4-dichloro-N-(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2448-04-6 | Molecular Weight | 300.56800 | |
| Density | 1.472g/cm3 | Boiling Point | 357.1ºC at 760mmHg | |
| Molecular Formula | C13H8Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8ºC | |
| Name | 3,4-dichloro-N-(4-chlorophenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.472g/cm3 |
|---|---|
| Boiling Point | 357.1ºC at 760mmHg |
| Molecular Formula | C13H8Cl3NO |
| Molecular Weight | 300.56800 |
| Flash Point | 169.8ºC |
| Exact Mass | 298.96700 |
| PSA | 29.10000 |
| LogP | 4.97210 |
| Vapour Pressure | 2.8E-05mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | DGFHQFZPMKCRIS-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc(Cl)c(Cl)c1 |
|
~%
Benzamide,3,4-d... CAS#:2448-04-6 |
| Literature: Beaver et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 1236,1242 Journal of Organic Chemistry, 1959 , vol. 24, p. 1676 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4-Dichlor-benzoesaeure-(4-chlor-anilid) |
| 3,4-dichloro-benzoic acid-(4-chloro-anilide) |
| Benzanilide,3,4,4'-trichloro |