3-nitrobenzenecarboperoxoic acid structure
|
Common Name | 3-nitrobenzenecarboperoxoic acid | ||
|---|---|---|---|---|
| CAS Number | 2453-41-0 | Molecular Weight | 183.11800 | |
| Density | 1.523g/cm3 | Boiling Point | 356.3ºC at 760 mmHg | |
| Molecular Formula | C7H5NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.3ºC | |
| Name | 3-nitrobenzenecarboperoxoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.523g/cm3 |
|---|---|
| Boiling Point | 356.3ºC at 760 mmHg |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.11800 |
| Flash Point | 169.3ºC |
| Exact Mass | 183.01700 |
| PSA | 92.35000 |
| LogP | 1.74780 |
| Vapour Pressure | 1.07E-05mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | OQOXQGCYFYSFRH-UHFFFAOYSA-N |
| SMILES | O=C(OO)c1cccc([N+](=O)[O-])c1 |
|
~93%
3-nitrobenzenec... CAS#:2453-41-0 |
| Literature: Pande, C. S.; Jain, Neena Synthetic Communications, 1988 , vol. 18, # 16-17 p. 2123 - 2128 |
|
~%
3-nitrobenzenec... CAS#:2453-41-0 |
| Literature: Lynch; Pausacker Journal of the Chemical Society, 1955 , p. 1525,1528 Full Text Show Details Medwedew; Bloch Zhurnal Fizicheskoi Khimii, 1933 , vol. 4, p. 721,723 Chem. Zentralbl., 1935 , vol. 106, # I p. 2670 |
| 3-nitroperbenzoic acid |
| meta-nitroperbenzoic acid |
| Benzenecarboperoxoicacid,3-nitro |
| meta-Nitroperoxybenzoic acid |
| m-nitroperbenzoic acid |
| 3-Nitro-peroxybenzoesaeure |
| m-Nitro-peroxybenzoesaeure |
| 3-nitro-peroxybenzoic acid |
| m-Nitroperoxybenzoic acid |