Cyclopropanecarboxylicacid, 1,2,2-tricyano-3,3-diethyl-, ethyl ester structure
|
Common Name | Cyclopropanecarboxylicacid, 1,2,2-tricyano-3,3-diethyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 24543-21-3 | Molecular Weight | 245.27700 | |
| Density | 1.16g/cm3 | Boiling Point | 430.1ºC at 760mmHg | |
| Molecular Formula | C13H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.9ºC | |
| Name | ethyl 1,2,2-tricyano-3,3-diethylcyclopropane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 430.1ºC at 760mmHg |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.27700 |
| Flash Point | 187.9ºC |
| Exact Mass | 245.11600 |
| PSA | 97.67000 |
| LogP | 1.91304 |
| Vapour Pressure | 1.33E-07mmHg at 25°C |
| Index of Refraction | 1.5 |
| InChIKey | LXMFDDLRYDCCOL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C#N)C(C#N)(C#N)C1(CC)CC |
|
~%
Cyclopropanecar... CAS#:24543-21-3 |
| Literature: Kim,Y.C.; Hart,H. Journal of the Chemical Society [Section] C: Organic, 1969 , p. 2409 - 2412 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3-Diaethyl-1,2,2-tricyan-cyclopropan-1-carbonsaeure-aethylester |
| Ethyl 1,2,2-tricyano-3,3-diethylcyclopropanecarboxylate |