Benzene,[[4-(1,1-dimethylethyl)cyclohexyl]sulfinyl]-, cis- (9CI) structure
|
Common Name | Benzene,[[4-(1,1-dimethylethyl)cyclohexyl]sulfinyl]-, cis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 2455-13-2 | Molecular Weight | 264.42600 | |
| Density | 1.06g/cm3 | Boiling Point | 393.3ºC at 760 mmHg | |
| Molecular Formula | C16H24OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.7ºC | |
| Name | (4-tert-butylcyclohexyl)sulfinylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 393.3ºC at 760 mmHg |
| Molecular Formula | C16H24OS |
| Molecular Weight | 264.42600 |
| Flash Point | 191.7ºC |
| Exact Mass | 264.15500 |
| PSA | 36.28000 |
| LogP | 5.26480 |
| Vapour Pressure | 4.86E-06mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | JXHBFOUDFANFLZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC(S(=O)c2ccccc2)CC1 |
|
~%
Benzene,[[4-(1,... CAS#:2455-13-2 |
| Literature: Eliel,E.L. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 855 - 859 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| cis-4-tert-butylcyclohexyl phenyl sulphoxide |