4,6-Dinitro-1H-indole structure
|
Common Name | 4,6-Dinitro-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 245524-93-0 | Molecular Weight | 207.143 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 434.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C8H5N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.5±23.2 °C | |
| Name | 4,6-dinitro-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 434.3±25.0 °C at 760 mmHg |
| Molecular Formula | C8H5N3O4 |
| Molecular Weight | 207.143 |
| Flash Point | 216.5±23.2 °C |
| Exact Mass | 207.028000 |
| PSA | 107.43000 |
| LogP | 1.54 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.759 |
| InChIKey | ZDIBNKJWLUKNHH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2cc[nH]c2c1 |
|
~70%
4,6-Dinitro-1H-... CAS#:245524-93-0 |
| Literature: The United States of America as represented by the Secretary of the Army Patent: US5969155 A1, 1999 ; |
|
~46%
4,6-Dinitro-1H-... CAS#:245524-93-0 |
| Literature: Samet; Zakharov; Semenov; Buchanan III; Gakh Synthetic Communications, 2001 , vol. 31, # 9 p. 1441 - 1445 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4,6-Dinitro-1H-indole |
| 1H-Indole,4,6-dinitro |
| 1H-Indole, 4,6-dinitro- |
| 4,6-dinitroindole |