iso-propyl 1-adamantanecarboxylate structure
|
Common Name | iso-propyl 1-adamantanecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 24556-16-9 | Molecular Weight | 222.323 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 265.9±8.0 °C at 760 mmHg | |
| Molecular Formula | C14H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.0±6.0 °C | |
| Name | propan-2-yl adamantane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 265.9±8.0 °C at 760 mmHg |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.323 |
| Flash Point | 115.0±6.0 °C |
| Exact Mass | 222.161987 |
| PSA | 26.30000 |
| LogP | 3.94 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | PHSXMXGYVSYRPF-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C12CC3CC(CC(C3)C1)C2 |
| HS Code | 2916209090 |
|---|
|
~96%
iso-propyl 1-ad... CAS#:24556-16-9 |
| Literature: Shono, Tatsuya; Ishige, Osamu; Uyama, Hiroshi; Kashimura, Shigenori Journal of Organic Chemistry, 1986 , vol. 51, # 4 p. 546 - 549 |
|
~%
iso-propyl 1-ad... CAS#:24556-16-9 |
| Literature: Takahashi, Kyoko; Shibagaki, Makoto; Kuno, Hideyuki; Matsushita, Hajime Chemistry Letters, 1989 , p. 1141 - 1144 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Isopropyl (3s,5s,7s)-1-adamantanecarboxylate |
| Tricyclo[3.3.1.1]decane-1-carboxylic acid, 1-methylethyl ester |
| isopropyl adamantane-1-carboxylate |
| ISOPROPYL ADAMANTAN-1-CARBOXYLATE |
| isopropyl 1-adamantanecarboxylate |
| F3095-4872 |
| adamantane-1-carboxylic acid isopropyl ester |
| methylethyl adamantanecarboxylate |
| iso-propyl 1-adamantanecarboxylate |