dihydrocubebin structure
|
Common Name | dihydrocubebin | ||
|---|---|---|---|---|
| CAS Number | 24563-03-9 | Molecular Weight | 358.38500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of dihydrocubebinDihydrocubebin is a compound isolated from Piper cubeba as potent and selective inhibitors against cytochrome P450 3A4 (CYP3A4)[1]. |
| Name | dihydrocubebin |
|---|---|
| Synonym | More Synonyms |
| Description | Dihydrocubebin is a compound isolated from Piper cubeba as potent and selective inhibitors against cytochrome P450 3A4 (CYP3A4)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H22O6 |
|---|---|
| Molecular Weight | 358.38500 |
| Exact Mass | 358.14200 |
| PSA | 77.38000 |
| LogP | 2.14620 |
| Vapour Pressure | 1.3E-14mmHg at 25°C |
| InChIKey | JKCVMTYNARDGET-HOTGVXAUSA-N |
| SMILES | OCC(Cc1ccc2c(c1)OCO2)C(CO)Cc1ccc2c(c1)OCO2 |
| Storage condition | 2-8°C |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2R,3R)-2,3-bis(1,3-benzodioxol-5-ylmethyl)butane-1,4-diol |
| Dihydrocubebin |