N-ethylethanamine,5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione structure
|
Common Name | N-ethylethanamine,5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 24573-29-3 | Molecular Weight | 305.37200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-ethylethanamine,5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H23N3O3 |
|---|---|
| Molecular Weight | 305.37200 |
| Exact Mass | 305.17400 |
| PSA | 94.28000 |
| LogP | 2.25890 |
| InChIKey | HRIVMPCILUGJNH-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)NC1=O.CCNCC |
| 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-ethyl-5-phenyl-,compd. with N-ethylethanamine (1:1) |
| Barbituric acid,5-ethyl-5-phenyl-,compd. with diethylamine (1:1) |
| Gratusminal (TN) |
| Diethylamine,compd. with 5-ethyl-5-phenylbarbituric acid (1:1) |
| Phenobarbital diethylamine |
| Diethylamine,5-ethyl-5-phenylbarbiturate |
| Phenobarbital diethylamine salt |
| UNII-RB423CG92E |