5-Bromo-1-(4-nitrophenyl)-3-(trifluoromethyl)-1h-pyrazole structure
|
Common Name | 5-Bromo-1-(4-nitrophenyl)-3-(trifluoromethyl)-1h-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 245748-62-3 | Molecular Weight | 336.06500 | |
| Density | 1.825g/cm3 | Boiling Point | 371.041ºC at 760 mmHg | |
| Molecular Formula | C10H5BrF3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.199ºC | |
| Name | 5-bromo-1-(4-nitrophenyl)-3-(trifluoromethyl)pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.825g/cm3 |
|---|---|
| Boiling Point | 371.041ºC at 760 mmHg |
| Molecular Formula | C10H5BrF3N3O2 |
| Molecular Weight | 336.06500 |
| Flash Point | 178.199ºC |
| Exact Mass | 334.95200 |
| PSA | 63.64000 |
| LogP | 4.08500 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | PHKUIOUZQWVAJB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(C(F)(F)F)cc2Br)cc1 |
| HS Code | 2933199090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-bromo-1-(4-nitrophenyl)-3-(trifluoromethyl)-1H-pyrazole |