3α,7α-dihydroxy-12-oxo-5β-cholanic acid
3α,7α-dihydroxy-12-oxo-5β-cholanic acid structure
|
Common Name | 3α,7α-dihydroxy-12-oxo-5β-cholanic acid | ||
|---|---|---|---|---|
| CAS Number | 2458-08-4 | Molecular Weight | 406.55600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H38O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3α,7α-dihydroxy-12-oxo-5β-cholanic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H38O5 |
|---|---|
| Molecular Weight | 406.55600 |
| Exact Mass | 406.27200 |
| PSA | 94.83000 |
| LogP | 3.65690 |
| InChIKey | MIHNUBCEFJLAGN-DMMBONCOSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(=O)C12C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
![methyl (4R)-4-[(3R,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate structure](https://image.chemsrc.com/caspic/091/10538-64-4.png)
CAS#:10538-64-4
CAS#:474-25-9
CAS#:56-49-5
CAS#:3057-04-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 12-oxo-chenodeoxycholic acid |
| 3alpha,7alpha-dihydroxy-12-oxo-5beta-cholanic acid |
| 12oxo-3α,7α-dihydroxy-5β-cholan-24-oic acid |
| 3α,7α-dihydroxy-12-oxo-5β-cholanoic acid |
| 3α,7α-dihydroxy-12-keto-5β-cholan-24-oic acid |
| 3α,7α-dihydroxy-12-oxo-5β-cholan-24-oic acid |
| 12-Oxochenodeoxycholic Acid |
| 12-oxochenodeoxycholic acid |
| 3α,7α-dihydoxy-12-oxo-5β-cholanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2458-08-4? |
| A: Chinese name of 2458-08-4 is 2458-08-4. |
| Q: What is the CAS number of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid? |
| A: CAS number of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid is 2458-08-4. |
| Q: What is the InChIKey of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid? |
| A: InChIKey of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid is MIHNUBCEFJLAGN-DMMBONCOSA-N. |
| Q: What English synonyms does 3α,7α-dihydroxy-12-oxo-5β-cholanic acid have? |
| A: English synonyms of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid: 12-oxo-chenodeoxycholic acid, 3alpha,7alpha-dihydroxy-12-oxo-5beta-cholanic acid, 12oxo-3α,7α-dihydroxy-5β-cholan-24-oic acid, 3α,7α-dihydroxy-12-oxo-5β-cholanoic acid, 3α,7α-dihydroxy-12-keto-5β-cholan-24-oic acid, 3α,7α-dihydroxy-12-oxo-5β-cholan-24-oic acid, 12-Oxochenodeoxycholic Acid, 12-oxochenodeoxycholic acid, 3α,7α-dihydoxy-12-oxo-5β-cholanoic acid. |
| Q: What are the downstream products of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid? |
| A: Related downstream products(CAS) of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid: 10538-64-4;474-25-9;56-49-5;3057-04-3. |
| Q: What is the molecular formula of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid? |
| A: Molecular formula of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid is C24H38O5. |
| Q: What is the molecular weight of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid? |
| A: Molecular weight of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid is 406.55600. |
| Q: What is the polar surface area (PSA) of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid? |
| A: Polar surface area (PSA) of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid is 94.83000. |
| Q: What is the English name of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid? |
| A: The English name of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid is 3α,7α-dihydroxy-12-oxo-5β-cholanic acid. |
| Q: What is the LogP of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid? |
| A: LogP of 3α,7α-dihydroxy-12-oxo-5β-cholanic acid is 3.65690. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |