1-(p-Phenethylphenyl)glyoxal structure
|
Common Name | 1-(p-Phenethylphenyl)glyoxal | ||
|---|---|---|---|---|
| CAS Number | 24585-99-7 | Molecular Weight | 238.28100 | |
| Density | 1.125g/cm3 | Boiling Point | 351.1ºC at 760mmHg | |
| Molecular Formula | C16H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.6ºC | |
| Name | 2-oxo-2-[4-(2-phenylethyl)phenyl]acetaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 351.1ºC at 760mmHg |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.28100 |
| Flash Point | 144.6ºC |
| Exact Mass | 238.09900 |
| PSA | 34.14000 |
| LogP | 2.85340 |
| Vapour Pressure | 4.19E-05mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | YEWSCLFUUYUKAE-UHFFFAOYSA-N |
| SMILES | O=CC(=O)c1ccc(CCc2ccccc2)cc1 |
| HS Code | 2914400090 |
|---|
|
~%
1-(p-Phenethylp... CAS#:24585-99-7 |
| Literature: Cavallini,G. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 255 - 258 |
|
~%
1-(p-Phenethylp... CAS#:24585-99-7 |
| Literature: Cavallini,G. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 255 - 258 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-oxo-2-(4-phenethylphenyl)acetaldehyde |
| p-(2-Phenylethyl)-phenyl-glyoxal |
| 4-Glyoxalyldiphenylethan |
| GLYOXAL,(p-PHENETHYLPHENYL) |
| (p-Phenethylphenyl)glyoxal |