Acetamide,N,N'-1,6-hexanediylbis[N-acetyl structure
|
Common Name | Acetamide,N,N'-1,6-hexanediylbis[N-acetyl | ||
|---|---|---|---|---|
| CAS Number | 2463-29-8 | Molecular Weight | 284.35100 | |
| Density | 1.082g/cm3 | Boiling Point | 441.6ºC at 760 mmHg | |
| Molecular Formula | C14H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.4ºC | |
| Name | N-acetyl-N-[6-(diacetylamino)hexyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.082g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760 mmHg |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.35100 |
| Flash Point | 189.4ºC |
| Exact Mass | 284.17400 |
| PSA | 74.76000 |
| LogP | 1.33680 |
| Vapour Pressure | 5.36E-08mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | LUVMRKKWOQTAQD-UHFFFAOYSA-N |
| SMILES | CC(=O)N(CCCCCCN(C(C)=O)C(C)=O)C(C)=O |
|
~69%
Acetamide,N,N'-... CAS#:2463-29-8 |
| Literature: Haces, Alberto; Breitman, Theodore B. R.; Driscoll, John S. Journal of Medicinal Chemistry, 1987 , vol. 30, # 2 p. 405 - 409 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N,N',N'-tetraacetylhexamethylenediamine |
| N.N.N'.N'-Tetraacetyl-hexamethylendiamin |
| N,N,N',N'-teraacetylhexamethylenediamine |
| Tetraacetyl-hexamethylen-diamin |