2-(4-Benzylpiperazin-1-yl)acetohydrazid structure
|
Common Name | 2-(4-Benzylpiperazin-1-yl)acetohydrazid | ||
|---|---|---|---|---|
| CAS Number | 24632-70-0 | Molecular Weight | 248.324 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 443.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.0±25.9 °C | |
| Name | 2-(4-benzylpiperazin-1-yl)acetohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 443.5±35.0 °C at 760 mmHg |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.324 |
| Flash Point | 222.0±25.9 °C |
| Exact Mass | 248.163712 |
| PSA | 61.60000 |
| LogP | -0.45 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | HPORNZWVEBQIOT-UHFFFAOYSA-N |
| SMILES | NNC(=O)CN1CCN(Cc2ccccc2)CC1 |
| HS Code | 2933599090 |
|---|
|
~97%
2-(4-Benzylpipe... CAS#:24632-70-0 |
| Literature: Astrand, O. Alexander H.; Aziz, Gulzeb; Ali, Sidra Farzand; Paulsen, Ragnhild E.; Hansen, Trond Vidar; Rongved, Pal Bioorganic and Medicinal Chemistry, 2013 , vol. 21, # 17 p. 5175 - 5181 |
|
~%
2-(4-Benzylpipe... CAS#:24632-70-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 23, # 2 p. 440 - 443 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-benzylpiperazin-1-yl)acetohydrazide |
| (4-benzyl-piperazin-1-yl)-acetic acid hydrazide |
| 1-Piperazineacetic acid, 4-(phenylmethyl)-, hydrazide |
| 2-(4-Benzyl-1-piperazinyl)acetohydrazide |
| 2-(4-Benzylpiperazin-1-yl)acetohydrazid |
| <4-Benzyl-piperazino>-essigsaeure-hydrazid |
| F3308-2725 |
| 2-[4-benzylpiperazinyl]acetohydrazide |