Methyl 2-(4-nitrophenyl)butanoate structure
|
Common Name | Methyl 2-(4-nitrophenyl)butanoate | ||
|---|---|---|---|---|
| CAS Number | 24646-25-1 | Molecular Weight | 223.22500 | |
| Density | 1.188g/cm3 | Boiling Point | 320.6ºC at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.5ºC | |
| Name | Methyl 2-(4-nitrophenyl)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 320.6ºC at 760 mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 134.5ºC |
| Exact Mass | 223.08400 |
| PSA | 72.12000 |
| LogP | 2.78460 |
| Vapour Pressure | 0.000314mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | RJRSBLADCYAQKP-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)OC)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
|
~97%
Methyl 2-(4-nit... CAS#:24646-25-1 |
| Literature: Achmatowicz, Osman; Malinowska, Iwona; Szechner, Barbara; Maurin, Jan K. Tetrahedron, 1997 , vol. 53, # 23 p. 7917 - 7928 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| CC-0725 |
| methylnitrophenylbutanoate |
| methyl 2-(4-nitrobenzene)butyrate |