4-[(4-Methyl-1-piperazinyl)methylene]-1,3-diphenyl-2-pyrazolin-5-one structure
|
Common Name | 4-[(4-Methyl-1-piperazinyl)methylene]-1,3-diphenyl-2-pyrazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 24665-76-7 | Molecular Weight | 346.42600 | |
| Density | 1.19g/cm3 | Boiling Point | 463.7ºC at 760mmHg | |
| Molecular Formula | C21H22N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.2ºC | |
| Name | (4Z)-4-[(4-methylpiperazin-1-yl)methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 463.7ºC at 760mmHg |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.42600 |
| Flash Point | 234.2ºC |
| Exact Mass | 346.17900 |
| PSA | 39.15000 |
| LogP | 1.94520 |
| Vapour Pressure | 8.88E-09mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | ATNGADDISFCROL-MNDPQUGUSA-N |
| SMILES | CN1CCN(C=C2C(=O)N(c3ccccc3)N=C2c2ccccc2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-methyl-piperazin-1-ylmethylene)-2,5-diphenyl-2,4-dihydro-pyrazol-3-one |
| 4-[(4-methyl-1-piperazinyl)methylene]-1,3-diphenyl-2-pyrazolin-5-one |
| 1,3-Diphenyl-4-(4-methyl-1-piperazinylmethylene)-2-pyrazolin-5-one |
| 2-Pyrazolin-5-one,1,3-diphenyl-4-(4-methyl-1-piperazinylmethylene) |
| 1,3-Diphenyl-4-(N'-methyl-N-piperazino)methylene-2-pyrazolin-5-one |