4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol
![4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol Structure](https://image.chemsrc.com/caspic/126/2467-04-1.png)
4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol structure
|
Common Name | 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol | ||
|---|---|---|---|---|
| CAS Number | 2467-04-1 | Molecular Weight | 216.23300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-(2-Hydroxyphenyl)methyl]benzene-1,3-diol (CAS: 2467-04-1), molecular formula C13H12O3, molecular weight 216.23300, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12O3 |
|---|---|
| Molecular Weight | 216.23300 |
| Exact Mass | 216.07900 |
| PSA | 60.69000 |
| LogP | 2.39420 |
| InChIKey | GRPCMHFKMBGKRZ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(Cc2ccccc2O)c(O)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-[(2-hydroxyph... CAS#:2467-04-1 |
| Literature: Sprung; Gladstone Journal of the American Chemical Society, 1949 , vol. 71, p. 2907,2909, 2912 |
|
~%
4-[(2-hydroxyph... CAS#:2467-04-1 |
| Literature: Sprung; Gladstone Journal of the American Chemical Society, 1949 , vol. 71, p. 2907,2909, 2912 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Salicyl-resorcin |
| 4-(2-Hydroxy-benzyl)-resorcin |
| (2-Hydroxy-phenyl)-(2,4-dihydroxy-phenyl)-methan |
| 1,3-Benzenediol,4-[(2-hydroxyphenyl)methyl] |
| 4-salicyl-resorcinol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol? |
| A: LogP of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol is 2.39420. |
| Q: What is the Chinese name of 2467-04-1? |
| A: Chinese name of 2467-04-1 is 2467-04-1. |
| Q: What are the upstream materials of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol? |
| A: Related upstream materials(CAS) of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol: 90-01-7;108-46-3;76-09-5. |
| Q: What is the SMILES notation of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol? |
| A: SMILES notation of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol is Oc1ccc(Cc2ccccc2O)c(O)c1. |
| Q: What English synonyms does 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol have? |
| A: English synonyms of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol: 4-Salicyl-resorcin, 4-(2-Hydroxy-benzyl)-resorcin, (2-Hydroxy-phenyl)-(2,4-dihydroxy-phenyl)-methan, 1,3-Benzenediol,4-[(2-hydroxyphenyl)methyl], 4-salicyl-resorcinol. |
| Q: What is the InChIKey of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol? |
| A: InChIKey of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol is GRPCMHFKMBGKRZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol? |
| A: Molecular weight of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol is 216.23300. |
| Q: What is the English name of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol? |
| A: The English name of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol is 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol. |
| Q: What is the polar surface area (PSA) of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol? |
| A: Polar surface area (PSA) of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol is 60.69000. |
| Q: What is the molecular formula of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol? |
| A: Molecular formula of 4-[(2-hydroxyphenyl)methyl]benzene-1,3-diol is C13H12O3. |