4,4'-Methylenebis(2-methylphenol) structure
|
Common Name | 4,4'-Methylenebis(2-methylphenol) | ||
|---|---|---|---|---|
| CAS Number | 2467-25-6 | Molecular Weight | 228.286 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 400.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H16O2 | Melting Point | 133ºC | |
| MSDS | N/A | Flash Point | 192.4±21.9 °C | |
| Name | 4-[(4-hydroxy-3-methylphenyl)methyl]-2-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 400.8±40.0 °C at 760 mmHg |
| Melting Point | 133ºC |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.286 |
| Flash Point | 192.4±21.9 °C |
| Exact Mass | 228.115036 |
| PSA | 40.46000 |
| LogP | 3.65 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | MIFGCULLADMRTF-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2ccc(O)c(C)c2)ccc1O |
| HS Code | 2907299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4,4'-Methylenebis(o-cresol) |
| Bis(4-hydroxy-3-methylphenyl)methane |
| 2,2'-Dimethyl-4,4'-methandiyl-di-phenol |
| 3,3'-dimethyl-4,4'-dihydroxydiphenylmethane |
| 2,2'-dimethyl-4,4'-methanediyl-di-phenol |
| 4.4'-Dioxy-3.3'-dimethyl-diphenylmethan |
| QC-4652 |
| 4,4'-Dihydroxy-3,3'-dimethyldiphenylmethane |
| 3,3'-dimethyl-4,4'-dihydroxyldiphenylmethane |
| 4,4'-Methylenebis(2-methylphenol) |