2-(Cyclopropylmethoxy)-acetic Acid 1,1-Dimethyl-2-[4-(Methylsulfonyl)phenyl]-2-oxoethyl Ester structure
|
Common Name | 2-(Cyclopropylmethoxy)-acetic Acid 1,1-Dimethyl-2-[4-(Methylsulfonyl)phenyl]-2-oxoethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 246869-15-8 | Molecular Weight | 354.41800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-methyl-1-(4-methylsulfonylphenyl)-1-oxopropan-2-yl] 2-(cyclopropylmethoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H22O6S |
|---|---|
| Molecular Weight | 354.41800 |
| Exact Mass | 354.11400 |
| PSA | 95.12000 |
| LogP | 3.10200 |
| InChIKey | CJEDNIAVNFONLO-UHFFFAOYSA-N |
| SMILES | CC(C)(OC(=O)COCC1CC1)C(=O)c1ccc(S(C)(=O)=O)cc1 |
|
~%
2-(Cyclopropylm... CAS#:246869-15-8 |
| Literature: Leblanc; Roy; Boyce; Brideau; Chan; Charleson; Gordon; Grimm; Guay; Leger; Li; Riendeau; Visco; Wang; Webb; Xu; Prasit Bioorganic and Medicinal Chemistry Letters, 1999 , vol. 9, # 15 p. 2207 - 2212 |
|
~%
2-(Cyclopropylm... CAS#:246869-15-8 |
| Literature: Leblanc; Roy; Boyce; Brideau; Chan; Charleson; Gordon; Grimm; Guay; Leger; Li; Riendeau; Visco; Wang; Webb; Xu; Prasit Bioorganic and Medicinal Chemistry Letters, 1999 , vol. 9, # 15 p. 2207 - 2212 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| [2-methyl-1-(4'-methylsulphonylphenyl)-1-oxo-prop-2-yl] 2-(cyclopropylmethoxy)acetate |
| 2-(Cyclopropylmethoxy)-acetic Acid 1,1-Dimethyl-2-[4-(methylsulfonyl)phenyl]-2-oxoethyl Ester |