Citronellyl tiglate structure
|
Common Name | Citronellyl tiglate | ||
|---|---|---|---|---|
| CAS Number | 24717-85-9 | Molecular Weight | 238.36600 | |
| Density | 0.893 g/cm3 | Boiling Point | 313.5ºC at 760 mmHg | |
| Molecular Formula | C15H26O2 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | >230 °F | |
| Name | Citronellyl tiglate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.893 g/cm3 |
|---|---|
| Boiling Point | 313.5ºC at 760 mmHg |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.36600 |
| Flash Point | >230 °F |
| Exact Mass | 238.19300 |
| PSA | 26.30000 |
| LogP | 4.26840 |
| Vapour Pressure | 0.000495mmHg at 25°C |
| Index of Refraction | n20/D 1.465(lit.) |
| InChIKey | UCFQYMKLDPWFHZ-MKMNVTDBSA-N |
| SMILES | CC=C(C)C(=O)OCCC(C)CCC=C(C)C |
| WGK Germany | 2 |
|---|---|
| HS Code | 2916190090 |
|
~%
Citronellyl tiglate CAS#:24717-85-9 |
| Literature: Chem. Zentralbl., , vol. 84, # II p. 1923 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Citronelloltiglat |
| Citronellyltiglat |
| Citronellol tiglate |
| CITRONELLYL-CROTONATE |
| Rhodinyl tiglate |
| 3,7-dimethyl-6-octenyl-2-methylcrotonate |
| Einecs 246-426-2 |