Diazene,(4-isothiocyanatophenyl)(4-nitrophenyl)- (9CI) structure
|
Common Name | Diazene,(4-isothiocyanatophenyl)(4-nitrophenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 24722-66-5 | Molecular Weight | 284.29300 | |
| Density | 1.33g/cm3 | Boiling Point | 495.6ºC at 760mmHg | |
| Molecular Formula | C13H8N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.5ºC | |
| Name | (4-isothiocyanatophenyl)-(4-nitrophenyl)diazene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 495.6ºC at 760mmHg |
| Molecular Formula | C13H8N4O2S |
| Molecular Weight | 284.29300 |
| Flash Point | 253.5ºC |
| Exact Mass | 284.03700 |
| PSA | 114.99000 |
| LogP | 5.26770 |
| Vapour Pressure | 1.78E-09mmHg at 25°C |
| Index of Refraction | 1.669 |
| InChIKey | HQLMTPHMWRDLGZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=Nc2ccc(N=C=S)cc2)cc1 |
|
~48%
Diazene,(4-isot... CAS#:24722-66-5 |
| Literature: Kato, Ryo; Kawai, Akinori; Hattori, Toshiaki New Journal of Chemistry, 2013 , vol. 37, # 3 p. 717 - 721 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(4-(Hydroxy(oxido)amino)phenyl)-2-(4-isothiocyanatophenyl)diazene |
| 4-nitro-4'-isothiocyanatoazobenzene |
| 4-nitroazobenzene 4'-isothiocyanate |
| (e)-1-(4-isothiocyanatophenyl)-2-(4-nitrophenyl)diazene |