4-(INDOL-3-YL)-DL-BETA-HOMOALANINE structure
|
Common Name | 4-(INDOL-3-YL)-DL-BETA-HOMOALANINE | ||
|---|---|---|---|---|
| CAS Number | 2474-01-3 | Molecular Weight | 218.25200 | |
| Density | 1.311g/cm3 | Boiling Point | 462.3ºC at 760mmHg | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.4ºC | |
| Name | 4-(INDOL-3-YL)-DL-β-HOMOALANINE |
|---|---|
| Synonym | More Synonyms |
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 462.3ºC at 760mmHg |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25200 |
| Flash Point | 233.4ºC |
| Exact Mass | 218.10600 |
| PSA | 79.11000 |
| LogP | 2.21270 |
| Vapour Pressure | 2.42E-09mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | DUVVFMLAHWNDJD-UHFFFAOYSA-N |
| SMILES | NC(CC(=O)O)Cc1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-amino-4-indol-3-yl-butyric acid |