2-Butenoic acid,3-bromo-4-oxo-4-[4-(pentyloxy)phenyl]- structure
|
Common Name | 2-Butenoic acid,3-bromo-4-oxo-4-[4-(pentyloxy)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 24740-92-9 | Molecular Weight | 341.19700 | |
| Density | 1.391g/cm3 | Boiling Point | 457.1ºC at 760 mmHg | |
| Molecular Formula | C15H17BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.3ºC | |
| Name | 2-Butenoic acid, 3-bromo-4-oxo-4-[4-(pentyloxy)phenyl]-, (E) |
|---|
| Density | 1.391g/cm3 |
|---|---|
| Boiling Point | 457.1ºC at 760 mmHg |
| Molecular Formula | C15H17BrO4 |
| Molecular Weight | 341.19700 |
| Flash Point | 230.3ºC |
| Exact Mass | 340.03100 |
| PSA | 63.60000 |
| LogP | 3.80170 |
| Vapour Pressure | 3.78E-09mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | KPUGJSNAPAAEJB-RAXLEYEMSA-N |
| SMILES | CCCCCOc1ccc(C(=O)C(Br)=CC(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |