Benzenepropanoic acid, a-ethyl-b-hydroxy-, ethyl ester structure
|
Common Name | Benzenepropanoic acid, a-ethyl-b-hydroxy-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 24744-97-6 | Molecular Weight | 222.28000 | |
| Density | 1.074g/cm3 | Boiling Point | 338.2ºC at 760mmHg | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138ºC | |
| Name | ethyl 2-[hydroxy(phenyl)methyl]butanoate |
|---|
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 338.2ºC at 760mmHg |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28000 |
| Flash Point | 138ºC |
| Exact Mass | 222.12600 |
| PSA | 46.53000 |
| LogP | 2.30930 |
| Vapour Pressure | 3.89E-05mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | MCJORAPHPVJYNZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC)C(O)c1ccccc1 |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |