1,4-Bis(propyl-amino) anthraquinone
Modify Date: 2026-07-25 13:11:06
1,4-Bis(propyl-amino) anthraquinone structure
|
Common Name | 1,4-Bis(propyl-amino) anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 2475-40-3 | Molecular Weight | 322.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-Bis(propyl-amino) anthraquinone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H22N2O2 |
|---|---|
| Molecular Weight | 322.4 |
| InChIKey | WPRQOPYKAPARST-UHFFFAOYSA-N |
| SMILES | CCCNc1ccc(NCCC)c2c1C(=O)c1ccccc1C2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,4-Bis(propyl-amino) anthraquinone? |
| A: The English name of 1,4-Bis(propyl-amino) anthraquinone is 1,4-Bis(propyl-amino) anthraquinone. |
| Q: What is the InChIKey of 1,4-Bis(propyl-amino) anthraquinone? |
| A: InChIKey of 1,4-Bis(propyl-amino) anthraquinone is WPRQOPYKAPARST-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,4-Bis(propyl-amino) anthraquinone? |
| A: Molecular formula of 1,4-Bis(propyl-amino) anthraquinone is C20H22N2O2. |
| Q: What is the SMILES notation of 1,4-Bis(propyl-amino) anthraquinone? |
| A: SMILES notation of 1,4-Bis(propyl-amino) anthraquinone is CCCNc1ccc(NCCC)c2c1C(=O)c1ccccc1C2=O. |
| Q: What is the CAS number of 1,4-Bis(propyl-amino) anthraquinone? |
| A: CAS number of 1,4-Bis(propyl-amino) anthraquinone is 2475-40-3. |
| Q: What is the Chinese name of 2475-40-3? |
| A: Chinese name of 2475-40-3 is 2475-40-3. |
| Q: What is the molecular weight of 1,4-Bis(propyl-amino) anthraquinone? |
| A: Molecular weight of 1,4-Bis(propyl-amino) anthraquinone is 322.4. |