cladribine related compound a (20 mg) (2-methoxy-2'-deoxyadenosine) structure
|
Common Name | cladribine related compound a (20 mg) (2-methoxy-2'-deoxyadenosine) | ||
|---|---|---|---|---|
| CAS Number | 24757-70-8 | Molecular Weight | 281.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of cladribine related compound a (20 mg) (2-methoxy-2'-deoxyadenosine)2-Methoxy-2’-deoxyadenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | (2R,3S,5R)-5-(6-amino-2-methoxypurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Methoxy-2’-deoxyadenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H15N5O4 |
|---|---|
| Molecular Weight | 281.27 |
| Exact Mass | 281.11200 |
| PSA | 128.54000 |
| InChIKey | HGRICISHTIAZJG-RRKCRQDMSA-N |
| SMILES | COc1nc(N)c2ncn(C3CC(O)C(CO)O3)c2n1 |
| RIDADR | NONH for all modes of transport |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 9|A-(2-Deoxy-D-ribofuranosyl)-2-methoxyadenine |
| 2-Methoxy-2'-deoxy-|A-adenosine |
| 2-Methoxy-6-amino-9-(2-deoxy-|A-D-erythro-pentofuranosyl)purine |
| Cladribine Related Compound A |
| 2-Methoxy-2'-deoxyadenosine |
| Adenosine,2'-deoxy-2-methoxy |
| 2'-Deoxy-2-methoxyadenosine |