1-Methyl-4-nitro-5-propyl-1H-pyrazole-3-carboxamide structure
|
Common Name | 1-Methyl-4-nitro-5-propyl-1H-pyrazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 247583-72-8 | Molecular Weight | 212.20600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-nitro-5-propylpyrazole-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H12N4O3 |
|---|---|
| Molecular Weight | 212.20600 |
| Exact Mass | 212.09100 |
| PSA | 106.73000 |
| LogP | 1.60320 |
| InChIKey | NCCQVNCBOLIFEF-UHFFFAOYSA-N |
| SMILES | CCCc1c([N+](=O)[O-])c(C(N)=O)nn1C |
|
~86%
1-Methyl-4-nitr... CAS#:247583-72-8 |
| Literature: El-Abadelah, Mustafa M.; Sabri, Salim S.; Khanfar, Monther A.; Yasin, Hani A.; Voelter, Wolfgang Journal of Heterocyclic Chemistry, 2002 , vol. 39, # 5 p. 1055 - 1059 |
|
~%
1-Methyl-4-nitr... CAS#:247583-72-8 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 39, # 5 p. 1055 - 1059 |
|
~%
1-Methyl-4-nitr... CAS#:247583-72-8 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 39, # 5 p. 1055 - 1059 |
| 1-METHYL-4-NITRO-5-PROPYL-1H-PYRAZOLE-3-CARBOXAMIDE |
| 2-Methyl-4-nitro-3-n-propylpyrazole-5-carboxamide |
| 1-methyl-4-nitro-5-propyl-3-pyrazolecarboxamide |