1,6-dimethyl-2-phenyl-1H-benzimidazole
Modify Date: 2026-07-18 07:20:20
1,6-dimethyl-2-phenyl-1H-benzimidazole structure
|
Common Name | 1,6-dimethyl-2-phenyl-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 24780-87-8 | Molecular Weight | 222.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,6-dimethyl-2-phenyl-1H-benzimidazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14N2 |
|---|---|
| Molecular Weight | 222.28 |
| InChIKey | RYTDKLCIKNBCPX-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(-c3ccccc3)n(C)c2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,6-dimethyl-2-phenyl-1H-benzimidazole? |
| A: Molecular formula of 1,6-dimethyl-2-phenyl-1H-benzimidazole is C15H14N2. |
| Q: What is the molecular weight of 1,6-dimethyl-2-phenyl-1H-benzimidazole? |
| A: Molecular weight of 1,6-dimethyl-2-phenyl-1H-benzimidazole is 222.28. |
| Q: What is the InChIKey of 1,6-dimethyl-2-phenyl-1H-benzimidazole? |
| A: InChIKey of 1,6-dimethyl-2-phenyl-1H-benzimidazole is RYTDKLCIKNBCPX-UHFFFAOYSA-N. |
| Q: What is the English name of 1,6-dimethyl-2-phenyl-1H-benzimidazole? |
| A: The English name of 1,6-dimethyl-2-phenyl-1H-benzimidazole is 1,6-dimethyl-2-phenyl-1H-benzimidazole. |
| Q: What is the SMILES notation of 1,6-dimethyl-2-phenyl-1H-benzimidazole? |
| A: SMILES notation of 1,6-dimethyl-2-phenyl-1H-benzimidazole is Cc1ccc2nc(-c3ccccc3)n(C)c2c1. |
| Q: What is the CAS number of 1,6-dimethyl-2-phenyl-1H-benzimidazole? |
| A: CAS number of 1,6-dimethyl-2-phenyl-1H-benzimidazole is 24780-87-8. |
| Q: What is the Chinese name of 24780-87-8? |
| A: Chinese name of 24780-87-8 is 24780-87-8. |