z-ile-ala-oh structure
|
Common Name | z-ile-ala-oh | ||
|---|---|---|---|---|
| CAS Number | 24787-83-5 | Molecular Weight | 336.38300 | |
| Density | 1.181g/cm3 | Boiling Point | 581.7ºC at 760mmHg | |
| Molecular Formula | C17H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.6ºC | |
| Name | z-ile-ala-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 581.7ºC at 760mmHg |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.38300 |
| Flash Point | 305.6ºC |
| Exact Mass | 336.16900 |
| PSA | 104.73000 |
| LogP | 2.69860 |
| Vapour Pressure | 2.26E-14mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | ODCYXWIILYCUCZ-OBJOEFQTSA-N |
| SMILES | CCC(C)C(NC(=O)OCc1ccccc1)C(=O)NC(C)C(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
z-ile-ala-oh CAS#:24787-83-5 |
| Literature: Lehmann, Juerg; Linden, Anthony; Heimgartner, Heinz Tetrahedron, 1998 , vol. 54, # 30 p. 8721 - 8736 |
|
~%
z-ile-ala-oh CAS#:24787-83-5 |
| Literature: Lehmann, Juerg; Linden, Anthony; Heimgartner, Heinz Tetrahedron, 1998 , vol. 54, # 30 p. 8721 - 8736 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Z-L-ISOLEUCYL-L-ALANINE |
| Einecs 246-459-2 |
| CBZ-Ile-Ala |
| N-CARBOBENZOXY-L-ISOLEUCYL-L-ALANINE |