2,2-bis-(4-Aminophenyl)propane structure
|
Common Name | 2,2-bis-(4-Aminophenyl)propane | ||
|---|---|---|---|---|
| CAS Number | 2479-47-2 | Molecular Weight | 226.31700 | |
| Density | 1.091g/cm3 | Boiling Point | 405.5ºC at 760mmHg | |
| Molecular Formula | C15H18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.1ºC | |
| Name | 4-[2-(4-aminophenyl)propan-2-yl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 405.5ºC at 760mmHg |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.31700 |
| Flash Point | 238.1ºC |
| Exact Mass | 226.14700 |
| PSA | 52.04000 |
| LogP | 4.33930 |
| Vapour Pressure | 8.76E-07mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | ZYEDGEXYGKWJPB-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(N)cc1)c1ccc(N)cc1 |
| HS Code | 2921590090 |
|---|
|
~90%
2,2-bis-(4-Amin... CAS#:2479-47-2 |
| Literature: US4177211 A1, ; |
|
~%
2,2-bis-(4-Amin... CAS#:2479-47-2 |
| Literature: Journal of the American Chemical Society, , vol. 118, # 35 p. 8395 - 8407 |
|
~%
2,2-bis-(4-Amin... CAS#:2479-47-2 |
| Literature: US4177211 A1, ; |
|
~%
2,2-bis-(4-Amin... CAS#:2479-47-2 |
| Literature: DE399149 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 721 |
|
~%
2,2-bis-(4-Amin... CAS#:2479-47-2 |
| Literature: DE399149 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 721 |
|
~%
2,2-bis-(4-Amin... CAS#:2479-47-2 |
| Literature: DE399149 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 721 |
|
~%
Detail
|
| Literature: Justus Liebigs Annalen der Chemie, , vol. 472, p. 34 |
| Precursor 6 | |
|---|---|
| DownStream 8 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-propan-2,2-diyldianilin |
| 4,4'-diaminodiphenyl-2,2-propane |
| 4,4'-Isopropylidenedianiline |