6-chloro-3-hydroxy-2-pyridin-3-yl-chromen-4-one structure
|
Common Name | 6-chloro-3-hydroxy-2-pyridin-3-yl-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 2481-67-6 | Molecular Weight | 273.67100 | |
| Density | 1.525g/cm3 | Boiling Point | 461.3ºC at 760 mmHg | |
| Molecular Formula | C14H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.8ºC | |
| Name | 6-chloro-3-hydroxy-2-pyridin-3-ylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.525g/cm3 |
|---|---|
| Boiling Point | 461.3ºC at 760 mmHg |
| Molecular Formula | C14H8ClNO3 |
| Molecular Weight | 273.67100 |
| Flash Point | 232.8ºC |
| Exact Mass | 273.01900 |
| PSA | 63.33000 |
| LogP | 3.21400 |
| Vapour Pressure | 2.62E-09mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | WJKGSPGPHGBKRY-UHFFFAOYSA-N |
| SMILES | O=c1c(O)c(-c2cccnc2)oc2ccc(Cl)cc12 |
|
~%
6-chloro-3-hydr... CAS#:2481-67-6 |
| Literature: Annigeri,A.C.; Siddappa,S. Indian Journal of Chemistry, 1964 , vol. 2, p. 413 - 415 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-chloro-3-hydroxy-2-pyridin-3-yl-chromen-4-one |
| 3'-Aza-6-chlor-flavonol |