m-[Bis(2-chloroethyl)amino]benzoic acid isopropyl ester structure
|
Common Name | m-[Bis(2-chloroethyl)amino]benzoic acid isopropyl ester | ||
|---|---|---|---|---|
| CAS Number | 24813-10-3 | Molecular Weight | 304.21200 | |
| Density | 1.195g/cm3 | Boiling Point | 414.1ºC at 760mmHg | |
| Molecular Formula | C14H19Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.2ºC | |
| Name | propan-2-yl 3-[bis(2-chloroethyl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 414.1ºC at 760mmHg |
| Molecular Formula | C14H19Cl2NO2 |
| Molecular Weight | 304.21200 |
| Flash Point | 204.2ºC |
| Exact Mass | 303.07900 |
| PSA | 29.54000 |
| LogP | 3.53580 |
| Vapour Pressure | 4.58E-07mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | XOIHXTHJKDKFSV-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1cccc(N(CCCl)CCCl)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| m-N-(Dichloraethylamino)-benzoesaeureisopropylester |
| m-(Bis(2-chloroethyl)amino)benzoic acid isopropyl ester |
| BENZOIC ACID,m-(BIS(2-CHLOROETHYL)AMINO)-,ISOPROPYL ESTER |