1,3-diethyl-1-(4-nitrophenyl)-3-phenylurea structure
|
Common Name | 1,3-diethyl-1-(4-nitrophenyl)-3-phenylurea | ||
|---|---|---|---|---|
| CAS Number | 24827-78-9 | Molecular Weight | 313.35100 | |
| Density | 1.244g/cm3 | Boiling Point | 461.1ºC at 760mmHg | |
| Molecular Formula | C17H19N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.7ºC | |
| Name | 1,3-diethyl-1-(4-nitrophenyl)-3-phenylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 461.1ºC at 760mmHg |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.35100 |
| Flash Point | 232.7ºC |
| Exact Mass | 313.14300 |
| PSA | 69.37000 |
| LogP | 4.59080 |
| Vapour Pressure | 1.1E-08mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | MWQXCGJYCCBRJK-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)N(CC)c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-Diaethyl-N-(4-nitro-phenyl)-N'-phenyl-harnstoff |
| EINECS 246-483-3 |
| Urea,N,N'-diethyl-N'-(4-nitrophenyl)-N-phenyl |
| N,N'-diethyl-N-(4-nitro-phenyl)-N'-phenyl-urea |