N-(O,O-dimethylphosphoryl)benzamide structure
|
Common Name | N-(O,O-dimethylphosphoryl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 24856-23-3 | Molecular Weight | 229.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(O,O-dimethylphosphoryl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12NO4P |
|---|---|
| Molecular Weight | 229.17000 |
| Exact Mass | 229.05000 |
| PSA | 74.44000 |
| LogP | 2.20820 |
| InChIKey | IJZVLPFIUWFOFA-UHFFFAOYSA-N |
| SMILES | COP(=O)(NC(=O)c1ccccc1)OC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| N-[dimethoxyphosphoryl]benzamide |
| Phosphorsaeure-dimethylester-benzamid |
| N-dimethoxyphosphinoylbenzamide |
| dimethyl benzoylphosphoramidate |
| benzoyl-amidophosphoric acid dimethyl ester |
| Benzoyl-amidophosphorsaeure-dimethylester |