methyl 2,5,7-trinitro-9-oxofluorene-4-carboxylate structure
|
Common Name | methyl 2,5,7-trinitro-9-oxofluorene-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 24867-50-3 | Molecular Weight | 373.23100 | |
| Density | 1.62g/cm3 | Boiling Point | 570.9ºC at 760 mmHg | |
| Molecular Formula | C15H7N3O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.6ºC | |
| Name | methyl 2,5,7-trinitro-9-oxofluorene-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 570.9ºC at 760 mmHg |
| Molecular Formula | C15H7N3O9 |
| Molecular Weight | 373.23100 |
| Flash Point | 257.6ºC |
| Exact Mass | 373.01800 |
| PSA | 180.83000 |
| LogP | 3.97880 |
| Vapour Pressure | 4.79E-13mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | IRTZYMPBFFNFSE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc2c1-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2=O |
|
~%
methyl 2,5,7-tr... CAS#:24867-50-3 |
| Literature: Sulzberg,T.; Cotter,R.J. Journal of Organic Chemistry, 1970 , vol. 35, # 8 p. 2762 - 2769 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| methyl 2,5,7-trinitrofluoren-9-one-4-carboxylate |
| methyl 2,5,7-trisnitro-9-oxo-9H-fluorene-4-carboxylate |
| methyl 2,5,7-trinitro-9-oxo-9H-fluorene-4-carboxylate |
| 2,4-DICHLORO-3-PICOLINE |