11beta,17,21-trihydroxypregn-4-ene-3,20-dione 21-pivalate structure
|
Common Name | 11beta,17,21-trihydroxypregn-4-ene-3,20-dione 21-pivalate | ||
|---|---|---|---|---|
| CAS Number | 24869-41-8 | Molecular Weight | 446.57600 | |
| Density | 1.21g/cm3 | Boiling Point | 594.9ºC at 760mmHg | |
| Molecular Formula | C26H38O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.9ºC | |
| Name | [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,2-dimethylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 594.9ºC at 760mmHg |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.57600 |
| Flash Point | 194.9ºC |
| Exact Mass | 446.26700 |
| PSA | 100.90000 |
| LogP | 3.37860 |
| Vapour Pressure | 1.24E-16mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | AQJJGJDBTXHKCP-XDANTLIUSA-N |
| SMILES | CC(C)(C)C(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C |
| Cortisol,21-pivalate (6CI,7CI,8CI) |
| 11beta,17,21-Trihydroxypregn-4-ene-3,20-dione 21-pivalate |
| Pivalic acid,21-ester with cortisol (8CI) |
| EINECS 246-508-8 |
| Pregn-4-ene-3,20-dione,21-(2,2-dimethyl-1-oxopropoxy)-11,17-dihydroxy-,(11b)-(9CI) |