2,7-Phenazinediol,5,10-dioxide
2,7-Phenazinediol,5,10-dioxide structure
|
Common Name | 2,7-Phenazinediol,5,10-dioxide | ||
|---|---|---|---|---|
| CAS Number | 24890-66-2 | Molecular Weight | 244.20300 | |
| Density | 1.7g/cm3 | Boiling Point | 561.5ºC at 760 mmHg | |
| Molecular Formula | C12H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 561.5ºC at 760 mmHg |
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.20300 |
| Flash Point | 293.4ºC |
| Exact Mass | 244.04800 |
| PSA | 91.38000 |
| LogP | 2.26120 |
| Vapour Pressure | 1.9E-13mmHg at 25°C |
| Index of Refraction | 1.82 |
| InChIKey | IPTPFONUNHLARK-UHFFFAOYSA-N |
| SMILES | [O-][n+]1c2ccc(O)cc2[n+]([O-])c2ccc(O)cc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:2089-15-8
CAS#:3372-79-0
CAS#:723318-90-9
CAS#:89-61-2
CAS#:95-03-4
CAS#:100-17-4
CAS#:5051-19-4
CAS#:104-94-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,10-Dioxy-phenazin-2,7-diol |
| 5,10-dioxy-phenazine-2,7-diol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one? |
| A: SMILES notation of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one is [O-][n+]1c2ccc(O)cc2[n+]([O-])c2ccc(O)cc21. |
| Q: What English synonyms does 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one have? |
| A: English synonyms of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one: 5,10-Dioxy-phenazin-2,7-diol, 5,10-dioxy-phenazine-2,7-diol. |
| Q: What is the molecular formula of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one? |
| A: Molecular formula of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one is C12H8N2O4. |
| Q: What is the InChIKey of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one? |
| A: InChIKey of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one is IPTPFONUNHLARK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 24890-66-2? |
| A: Chinese name of 24890-66-2 is 24890-66-2. |
| Q: What is the LogP of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one? |
| A: LogP of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one is 2.26120. |
| Q: What is the boiling point of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one? |
| A: Boiling point of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one is 561.5ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one? |
| A: Polar surface area (PSA) of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one is 91.38000. |
| Q: What are the upstream materials of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one? |
| A: Related upstream materials(CAS) of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one: 2089-15-8;3372-79-0;723318-90-9;89-61-2;95-03-4;100-17-4;5051-19-4;104-94-9. |
| Q: What is the molecular weight of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one? |
| A: Molecular weight of 7,10-dihydroxy-5-oxidophenazin-5-ium-2-one is 244.20300. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |