BENZAPYRIN structure
|
Common Name | BENZAPYRIN | ||
|---|---|---|---|---|
| CAS Number | 24891-21-2 | Molecular Weight | 322.36100 | |
| Density | 1.34g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.36100 |
| Exact Mass | 322.14300 |
| PSA | 82.05000 |
| LogP | 2.97310 |
| Index of Refraction | 1.69 |
| InChIKey | UPILTCFJXWMRIU-UHFFFAOYSA-N |
| SMILES | Cc1c(NC(=O)c2ccc(N)cc2)c(=O)n(-c2ccccc2)n1C |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-p-Aminobenzoylaminoantipyrine |
| Benzamide,4-amino-N-(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl) |
| 1-Phenyl-2,3-dimethyl-4-p-aminobenzoylamino-5-pyrazolone |
| p-Amino-N-antipyrinylbenzamide |
| 4-(4-Aminobenzoyl)aminoantipyrin |
| 4-(p-Amino-benzamino)-antipyrin |
| 4-amino-N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-benzamide |
| 4-<4-Amino-benzamino>-2,3-dimethyl-1-phenyl-pyrazolon-(5) |
| p-Aminobenzoic acid antipyrylamide |
| Ambepyrine |
| Antipyrine,4-(p-aminobenzamido)-(6CI,7CI) |