Methyl 4-methoxy-7-methyl-2-naphthoate
Methyl 4-methoxy-7-methyl-2-naphthoate structure
|
Common Name | Methyl 4-methoxy-7-methyl-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 24894-75-5 | Molecular Weight | 230.25900 | |
| Density | 1.141g/cm3 | Boiling Point | 366.1ºC at 760 mmHg | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-methoxy-7-methyl-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 366.1ºC at 760 mmHg |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.25900 |
| Flash Point | 153.1ºC |
| Exact Mass | 230.09400 |
| PSA | 35.53000 |
| LogP | 2.94340 |
| Vapour Pressure | 1.5E-05mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | TXNFTNGNUKAMDO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2ccc(C)cc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Methyl 4-methox... CAS#:24894-75-5 |
| Literature: Jordanides,C. Justus Liebigs Annalen der Chemie, 1969 , vol. 729, p. 240 - 243 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:24894-76-6
CAS#:24894-78-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Methoxy-6-methyl-naphthalin-3-carbonsaeure-methylester |
| 1-Methoxy-6-hydroxynaphthacene-5,12-dione |
| 1-Methoxy-6-methyl-naphthalin-3-carbonsaeure |
| 5,12-Naphthacenedione,6-hydroxy-1-methoxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl 4-methoxy-7-methyl-2-naphthoate? |
| A: InChIKey of Methyl 4-methoxy-7-methyl-2-naphthoate is TXNFTNGNUKAMDO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 4-methoxy-7-methyl-2-naphthoate? |
| A: Molecular formula of Methyl 4-methoxy-7-methyl-2-naphthoate is C14H14O3. |
| Q: What are the downstream products of Methyl 4-methoxy-7-methyl-2-naphthoate? |
| A: Related downstream products(CAS) of Methyl 4-methoxy-7-methyl-2-naphthoate: 24894-76-6;24894-78-8. |
| Q: What are the upstream materials of Methyl 4-methoxy-7-methyl-2-naphthoate? |
| A: Related upstream materials(CAS) of Methyl 4-methoxy-7-methyl-2-naphthoate: 24894-73-3;77-78-1. |
| Q: What English synonyms does Methyl 4-methoxy-7-methyl-2-naphthoate have? |
| A: English synonyms of Methyl 4-methoxy-7-methyl-2-naphthoate: 1-Methoxy-6-methyl-naphthalin-3-carbonsaeure-methylester, 1-Methoxy-6-hydroxynaphthacene-5,12-dione, 1-Methoxy-6-methyl-naphthalin-3-carbonsaeure, 5,12-Naphthacenedione,6-hydroxy-1-methoxy. |
| Q: What is the CAS number of Methyl 4-methoxy-7-methyl-2-naphthoate? |
| A: CAS number of Methyl 4-methoxy-7-methyl-2-naphthoate is 24894-75-5. |
| Q: What is the LogP of Methyl 4-methoxy-7-methyl-2-naphthoate? |
| A: LogP of Methyl 4-methoxy-7-methyl-2-naphthoate is 2.94340. |
| Q: What is the SMILES notation of Methyl 4-methoxy-7-methyl-2-naphthoate? |
| A: SMILES notation of Methyl 4-methoxy-7-methyl-2-naphthoate is COC(=O)c1cc(OC)c2ccc(C)cc2c1. |
| Q: What is the English name of Methyl 4-methoxy-7-methyl-2-naphthoate? |
| A: The English name of Methyl 4-methoxy-7-methyl-2-naphthoate is Methyl 4-methoxy-7-methyl-2-naphthoate. |
| Q: What is the molecular weight of Methyl 4-methoxy-7-methyl-2-naphthoate? |
| A: Molecular weight of Methyl 4-methoxy-7-methyl-2-naphthoate is 230.25900. |